C17H20ClN3O5S — CID 87399861
2-[[[4-(3-chloropropoxy)phenyl]sulfonyl-pyridin-3-ylmethyl]amino]-N-hydroxyacetamide (PubChem CID 87399861) has the molecular formula C17H20ClN3O5S and a molecular weight of 413.88 g/mol. Its IUPAC name is 2-[[[4-(3-chloropropoxy)phenyl]sulfonyl-pyridin-3-ylmethyl]amino]-N-hydroxyacetamide.
| Compound Name | 2-[[[4-(3-chloropropoxy)phenyl]sulfonyl-pyridin-3-ylmethyl]amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 87399861 |
| Molecular Formula | C17H20ClN3O5S |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 2-[[[4-(3-chloropropoxy)phenyl]sulfonyl-pyridin-3-ylmethyl]amino]-N-hydroxyacetamide |
| SMILES | O=C(CNC(c1cccnc1)S(=O)(=O)c1ccc(OCCCCl)cc1)NO |
| InChI | InChI=1S/C17H20ClN3O5S/c18-8-2-10-26-14-4-6-15(7-5-14)27(24,25)17(20-12-16(22)21-23)13-3-1-9-19-11-13/h1,3-7,9,11,17,20,23H,2,8,10,12H2,(H,21,22) |
| InChIKey | LPERGXJMNIRFGZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|