C14H17I3N2O6 — CID 87402693
3-N,3-N-bis(1,3-dihydroxypropan-2-yl)-2,4,6-triiodobenzene-1,3-dicarboxamide (PubChem CID 87402693) has the molecular formula C14H17I3N2O6 and a molecular weight of 690.01 g/mol. Its IUPAC name is 3-N,3-N-bis(1,3-dihydroxypropan-2-yl)-2,4,6-triiodobenzene-1,3-dicarboxamide.
| Compound Name | 3-N,3-N-bis(1,3-dihydroxypropan-2-yl)-2,4,6-triiodobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 87402693 |
| Molecular Formula | C14H17I3N2O6 |
| Molecular Weight | 690.01 g/mol |
| Exact Mass | 689.82 |
| IUPAC Name | 3-N,3-N-bis(1,3-dihydroxypropan-2-yl)-2,4,6-triiodobenzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1c(I)cc(I)c(C(=O)N(C(CO)CO)C(CO)CO)c1I |
| InChI | InChI=1S/C14H17I3N2O6/c15-8-1-9(16)11(12(17)10(8)13(18)24)14(25)19(6(2-20)3-21)7(4-22)5-23/h1,6-7,20-23H,2-5H2,(H2,18,24) |
| InChIKey | VGSKKQWEXDKYIK-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.01 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|