C19H18O6S — CID 87403047
[2-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-2-oxoethyl] 4-methylbenzenesulfonate (PubChem CID 87403047) has the molecular formula C19H18O6S and a molecular weight of 374.41 g/mol. Its IUPAC name is [2-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-2-oxoethyl] 4-methylbenzenesulfonate.
| Compound Name | [2-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-2-oxoethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87403047 |
| Molecular Formula | C19H18O6S |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | [2-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-2-oxoethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(=O)C2=COC=C(C3=CC=CCC3)O2)cc1 |
| InChI | InChI=1S/C19H18O6S/c1-14-7-9-16(10-8-14)26(21,22)24-11-17(20)19-13-23-12-18(25-19)15-5-3-2-4-6-15/h2-3,5,7-10,12-13H,4,6,11H2,1H3 |
| InChIKey | HQNGTLFKWQYDIP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|