C34H40N6O8 — CID 87414459
dibenzyl (2R)-2-[[6-[3-hydroxypropyl(2-methoxyethyl)amino]-5-isocyano-3-morpholin-4-ylpyrazine-2-carbonyl]amino]butanedioate (PubChem CID 87414459) has the molecular formula C34H40N6O8 and a molecular weight of 660.73 g/mol. Its IUPAC name is dibenzyl (2R)-2-[[6-[3-hydroxypropyl(2-methoxyethyl)amino]-5-isocyano-3-morpholin-4-ylpyrazine-2-carbonyl]amino]butanedioate.
| Compound Name | dibenzyl (2R)-2-[[6-[3-hydroxypropyl(2-methoxyethyl)amino]-5-isocyano-3-morpholin-4-ylpyrazine-2-carbonyl]amino]butanedioate |
|---|---|
| PubChem CID | 87414459 |
| Molecular Formula | C34H40N6O8 |
| Molecular Weight | 660.73 g/mol |
| Exact Mass | 660.29 |
| IUPAC Name | dibenzyl (2R)-2-[[6-[3-hydroxypropyl(2-methoxyethyl)amino]-5-isocyano-3-morpholin-4-ylpyrazine-2-carbonyl]amino]butanedioate |
| SMILES | [C-]#[N+]c1nc(N2CCOCC2)c(C(=O)N[C@H](CC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)nc1N(CCCO)CCOC |
| InChI | InChI=1S/C34H40N6O8/c1-35-30-32(39(14-9-18-41)15-19-45-2)37-29(31(38-30)40-16-20-46-21-17-40)33(43)36-27(34(44)48-24-26-12-7-4-8-13-26)22-28(42)47-23-25-10-5-3-6-11-25/h3-8,10-13,27,41H,9,14-24H2,2H3,(H,36,43)/t27-/m1/s1 |
| InChIKey | NSKHNNFIZVDFLH-HHHXNRCGSA-N |
| XLogP | 2.67 |
| TPSA | 157.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.73 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|