C30H30ClN5O7 — CID 146604293
dibenzyl 2-[[3-chloro-5-cyano-6-[2-methoxyethyl(3-oxopropyl)amino]pyrazine-2-carbonyl]amino]butanedioate (PubChem CID 146604293) has the molecular formula C30H30ClN5O7 and a molecular weight of 608.05 g/mol. Its IUPAC name is dibenzyl 2-[[3-chloro-5-cyano-6-[2-methoxyethyl(3-oxopropyl)amino]pyrazine-2-carbonyl]amino]butanedioate.
| Compound Name | dibenzyl 2-[[3-chloro-5-cyano-6-[2-methoxyethyl(3-oxopropyl)amino]pyrazine-2-carbonyl]amino]butanedioate |
|---|---|
| PubChem CID | 146604293 |
| Molecular Formula | C30H30ClN5O7 |
| Molecular Weight | 608.05 g/mol |
| Exact Mass | 607.18 |
| IUPAC Name | dibenzyl 2-[[3-chloro-5-cyano-6-[2-methoxyethyl(3-oxopropyl)amino]pyrazine-2-carbonyl]amino]butanedioate |
| SMILES | COCCN(CCC=O)c1nc(C(=O)NC(CC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)c(Cl)nc1C#N |
| InChI | InChI=1S/C30H30ClN5O7/c1-41-16-14-36(13-8-15-37)28-24(18-32)33-27(31)26(35-28)29(39)34-23(30(40)43-20-22-11-6-3-7-12-22)17-25(38)42-19-21-9-4-2-5-10-21/h2-7,9-12,15,23H,8,13-14,16-17,19-20H2,1H3,(H,34,39) |
| InChIKey | YJMRWGBGEYAXOJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 160.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.05 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|