About (2-hydrazinylhydrazinyl) nitrate
(2-hydrazinylhydrazinyl) nitrate (PubChem CID 87424472) has the molecular formula H5N5O3
and a molecular weight of 123.07 g/mol. Its IUPAC name is (2-hydrazinylhydrazinyl) nitrate.
Molecular Properties
| Compound Name | (2-hydrazinylhydrazinyl) nitrate |
| PubChem CID | 87424472 |
| Molecular Formula | H5N5O3 |
| Molecular Weight | 123.07 g/mol |
| Exact Mass | 123.04 |
| IUPAC Name | (2-hydrazinylhydrazinyl) nitrate |
| SMILES | NNNNO[N+](=O)[O-] |
| InChI | InChI=1S/H5N5O3/c1-2-3-4-8-5(6)7/h2-4H,1H2 |
| InChIKey | DQNKUPYQEIBWNZ-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.07 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-hydrazinylhydrazinyl) nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydrazinylhydrazinyl) nitrate?
The IUPAC name of (2-hydrazinylhydrazinyl) nitrate (CID 87424472) is (2-hydrazinylhydrazinyl) nitrate.
What is the SMILES notation for (2-hydrazinylhydrazinyl) nitrate?
The canonical SMILES for (2-hydrazinylhydrazinyl) nitrate is NNNNO[N+](=O)[O-].
What is the InChIKey of (2-hydrazinylhydrazinyl) nitrate?
The InChIKey is DQNKUPYQEIBWNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/H5N5O3/c1-2-3-4-8-5(6)7/h2-4H,1H2.
What are the key properties of (2-hydrazinylhydrazinyl) nitrate?
(2-hydrazinylhydrazinyl) nitrate has a molecular weight of 123.07 g/mol, XLogP of -2.42, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydrazinylhydrazinyl) nitrate is sourced from PubChem (CID 87424472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).