C28H31F5O3 — CID 87432709
(5R,8S,11R,13S,14S,17S)-11-(4-ethenylphenyl)-5,17-dihydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 87432709) has the molecular formula C28H31F5O3 and a molecular weight of 510.54 g/mol. Its IUPAC name is (5R,8S,11R,13S,14S,17S)-11-(4-ethenylphenyl)-5,17-dihydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (5R,8S,11R,13S,14S,17S)-11-(4-ethenylphenyl)-5,17-dihydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 87432709 |
| Molecular Formula | C28H31F5O3 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | (5R,8S,11R,13S,14S,17S)-11-(4-ethenylphenyl)-5,17-dihydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C=Cc1ccc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C(F)(F)C(F)(F)F)[C@@H]3CC[C@@]4(O)CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C28H31F5O3/c1-3-16-4-6-17(7-5-16)20-15-24(2)21(11-13-26(24,36)27(29,30)28(31,32)33)19-10-12-25(35)14-18(34)8-9-22(25)23(19)20/h3-7,19-21,35-36H,1,8-15H2,2H3/t19-,20+,21-,24-,25+,26-/m0/s1 |
| InChIKey | HEXMAWOAKYOPFZ-DEUWXWQDSA-N |
| XLogP | 6.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|