C13H14F2N2O2 — CID 87441232
ethyl N-cyano-2-(2,4-difluorophenoxy)-2-methylpropanimidate (PubChem CID 87441232) has the molecular formula C13H14F2N2O2 and a molecular weight of 268.26 g/mol. Its IUPAC name is ethyl N-cyano-2-(2,4-difluorophenoxy)-2-methylpropanimidate.
| Compound Name | ethyl N-cyano-2-(2,4-difluorophenoxy)-2-methylpropanimidate |
|---|---|
| PubChem CID | 87441232 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | ethyl N-cyano-2-(2,4-difluorophenoxy)-2-methylpropanimidate |
| SMILES | CCO/C(=N\C#N)C(C)(C)Oc1ccc(F)cc1F |
| InChI | InChI=1S/C13H14F2N2O2/c1-4-18-12(17-8-16)13(2,3)19-11-6-5-9(14)7-10(11)15/h5-7H,4H2,1-3H3/b17-12- |
| InChIKey | RZMZXTIYYUCMCA-ATVHPVEESA-N |
| XLogP | 3.04 |
| TPSA | 54.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|