C15H8Cl4O — CID 87444708
(E)-3-chloro-2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)prop-2-enal (PubChem CID 87444708) has the molecular formula C15H8Cl4O and a molecular weight of 346.04 g/mol. Its IUPAC name is (E)-3-chloro-2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)prop-2-enal.
| Compound Name | (E)-3-chloro-2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)prop-2-enal |
|---|---|
| PubChem CID | 87444708 |
| Molecular Formula | C15H8Cl4O |
| Molecular Weight | 346.04 g/mol |
| Exact Mass | 343.93 |
| IUPAC Name | (E)-3-chloro-2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)prop-2-enal |
| SMILES | O=C/C(=C(/Cl)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H8Cl4O/c16-10-3-1-9(2-4-10)13(8-20)15(19)12-6-5-11(17)7-14(12)18/h1-8H/b15-13- |
| InChIKey | XQWKHKJOWPQPSH-SQFISAMPSA-N |
| XLogP | 5.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.04 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|