C16H9Cl3O — CID 141173977
2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)buta-1,3-dien-1-one (PubChem CID 141173977) has the molecular formula C16H9Cl3O and a molecular weight of 323.61 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)buta-1,3-dien-1-one.
| Compound Name | 2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)buta-1,3-dien-1-one |
|---|---|
| PubChem CID | 141173977 |
| Molecular Formula | C16H9Cl3O |
| Molecular Weight | 323.61 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)buta-1,3-dien-1-one |
| SMILES | C=C(C(=C=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H9Cl3O/c1-10(14-7-6-13(18)8-16(14)19)15(9-20)11-2-4-12(17)5-3-11/h2-8H,1H2 |
| InChIKey | LSCMGGQXXWCBET-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|