About (Z)-3-bromo-3-(2,4-dichlorophenyl)prop-2-enal
(Z)-3-bromo-3-(2,4-dichlorophenyl)prop-2-enal (PubChem CID 167435363) has the molecular formula C9H5BrCl2O
and a molecular weight of 279.95 g/mol. Its IUPAC name is (Z)-3-bromo-3-(2,4-dichlorophenyl)prop-2-enal.
Molecular Properties
| Compound Name | (Z)-3-bromo-3-(2,4-dichlorophenyl)prop-2-enal |
| PubChem CID | 167435363 |
| Molecular Formula | C9H5BrCl2O |
| Molecular Weight | 279.95 g/mol |
| Exact Mass | 277.89 |
| IUPAC Name | (Z)-3-bromo-3-(2,4-dichlorophenyl)prop-2-enal |
| SMILES | O=C/C=C(\Br)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H5BrCl2O/c10-8(3-4-13)7-2-1-6(11)5-9(7)12/h1-5H/b8-3- |
| InChIKey | DHEACMKDXMOABH-BAQGIRSFSA-N |
| XLogP | 3.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.95 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-bromo-3-(2,4-dichlorophenyl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-bromo-3-(2,4-dichlorophenyl)prop-2-enal?
The IUPAC name of (Z)-3-bromo-3-(2,4-dichlorophenyl)prop-2-enal (CID 167435363) is (Z)-3-bromo-3-(2,4-dichlorophenyl)prop-2-enal.
What is the SMILES notation for (Z)-3-bromo-3-(2,4-dichlorophenyl)prop-2-enal?
The canonical SMILES for (Z)-3-bromo-3-(2,4-dichlorophenyl)prop-2-enal is O=C/C=C(\Br)c1ccc(Cl)cc1Cl.
What is the InChIKey of (Z)-3-bromo-3-(2,4-dichlorophenyl)prop-2-enal?
The InChIKey is DHEACMKDXMOABH-BAQGIRSFSA-N. The full InChI is InChI=1S/C9H5BrCl2O/c10-8(3-4-13)7-2-1-6(11)5-9(7)12/h1-5H/b8-3-.
What are the key properties of (Z)-3-bromo-3-(2,4-dichlorophenyl)prop-2-enal?
(Z)-3-bromo-3-(2,4-dichlorophenyl)prop-2-enal has a molecular weight of 279.95 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-bromo-3-(2,4-dichlorophenyl)prop-2-enal is sourced from PubChem (CID 167435363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).