About potassium;(diaminomethylideneamino) thiocyanate;iodide
potassium;(diaminomethylideneamino) thiocyanate;iodide (PubChem CID 87458802) has the molecular formula C2H4IKN4S
and a molecular weight of 282.15 g/mol. Its IUPAC name is potassium;(diaminomethylideneamino) thiocyanate;iodide.
Molecular Properties
| Compound Name | potassium;(diaminomethylideneamino) thiocyanate;iodide |
| PubChem CID | 87458802 |
| Molecular Formula | C2H4IKN4S |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 281.88 |
| IUPAC Name | potassium;(diaminomethylideneamino) thiocyanate;iodide |
| SMILES | N#CSN=C(N)N.[I-].[K+] |
| InChI | InChI=1S/C2H4N4S.HI.K/c3-1-7-6-2(4)5;;/h(H4,4,5,6);1H;/q;;+1/p-1 |
| InChIKey | KGDGMWQPUAULLG-UHFFFAOYSA-M |
| XLogP | -6.60 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | -6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium;(diaminomethylideneamino) thiocyanate;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;(diaminomethylideneamino) thiocyanate;iodide?
The IUPAC name of potassium;(diaminomethylideneamino) thiocyanate;iodide (CID 87458802) is potassium;(diaminomethylideneamino) thiocyanate;iodide.
What is the SMILES notation for potassium;(diaminomethylideneamino) thiocyanate;iodide?
The canonical SMILES for potassium;(diaminomethylideneamino) thiocyanate;iodide is N#CSN=C(N)N.[I-].[K+].
What is the InChIKey of potassium;(diaminomethylideneamino) thiocyanate;iodide?
The InChIKey is KGDGMWQPUAULLG-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4N4S.HI.K/c3-1-7-6-2(4)5;;/h(H4,4,5,6);1H;/q;;+1/p-1.
What are the key properties of potassium;(diaminomethylideneamino) thiocyanate;iodide?
potassium;(diaminomethylideneamino) thiocyanate;iodide has a molecular weight of 282.15 g/mol, XLogP of -6.60, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;(diaminomethylideneamino) thiocyanate;iodide is sourced from PubChem (CID 87458802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).