About CID 87459917
CID 87459917 (PubChem CID 87459917) has the molecular formula C2H8Br2GeN
and a molecular weight of 278.51 g/mol.
Molecular Properties
| Compound Name | CID 87459917 |
| PubChem CID | 87459917 |
| Molecular Formula | C2H8Br2GeN |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 277.82 |
| IUPAC Name | — |
| SMILES | Br.Br.CN(C)[Ge] |
| InChI | InChI=1S/C2H6GeN.2BrH/c1-4(2)3;;/h1-2H3;2*1H |
| InChIKey | CPQDBGFEUTWWDI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 87459917 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87459917?
The IUPAC name of CID 87459917 (CID 87459917) is not available.
What is the SMILES notation for CID 87459917?
The canonical SMILES for CID 87459917 is Br.Br.CN(C)[Ge].
What is the InChIKey of CID 87459917?
The InChIKey is CPQDBGFEUTWWDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6GeN.2BrH/c1-4(2)3;;/h1-2H3;2*1H.
What are the key properties of CID 87459917?
CID 87459917 has a molecular weight of 278.51 g/mol, XLogP of 0.79, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87459917 is sourced from PubChem (CID 87459917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).