C19H18ClN5O2S — CID 8746174
1-(3-chloro-4-methylphenyl)-3-[(3-ethyl-4-oxophthalazine-1-carbonyl)amino]thiourea (PubChem CID 8746174) has the molecular formula C19H18ClN5O2S and a molecular weight of 415.91 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[(3-ethyl-4-oxophthalazine-1-carbonyl)amino]thiourea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[(3-ethyl-4-oxophthalazine-1-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 8746174 |
| Molecular Formula | C19H18ClN5O2S |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[(3-ethyl-4-oxophthalazine-1-carbonyl)amino]thiourea |
| SMILES | CCn1nc(C(=O)NNC(=S)Nc2ccc(C)c(Cl)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C19H18ClN5O2S/c1-3-25-18(27)14-7-5-4-6-13(14)16(24-25)17(26)22-23-19(28)21-12-9-8-11(2)15(20)10-12/h4-10H,3H2,1-2H3,(H,22,26)(H2,21,23,28) |
| InChIKey | ZFNKYSIDAIADFR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|