C11H20N3O9PS — CID 87462971
2-amino-5-[[1-[carboxymethyl(phosphonomethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 87462971) has the molecular formula C11H20N3O9PS and a molecular weight of 401.33 g/mol. Its IUPAC name is 2-amino-5-[[1-[carboxymethyl(phosphonomethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[1-[carboxymethyl(phosphonomethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 87462971 |
| Molecular Formula | C11H20N3O9PS |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 2-amino-5-[[1-[carboxymethyl(phosphonomethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)NC(CS)C(=O)N(CC(=O)O)CP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C11H20N3O9PS/c12-6(11(19)20)1-2-8(15)13-7(4-25)10(18)14(3-9(16)17)5-24(21,22)23/h6-7,25H,1-5,12H2,(H,13,15)(H,16,17)(H,19,20)(H2,21,22,23) |
| InChIKey | JLDJSJZTFHOBJQ-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 207.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|