C14H23N3O7S — CID 54188024
2-amino-5-[[1-[butanoyl(carboxymethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 54188024) has the molecular formula C14H23N3O7S and a molecular weight of 377.42 g/mol. Its IUPAC name is 2-amino-5-[[1-[butanoyl(carboxymethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[1-[butanoyl(carboxymethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 54188024 |
| Molecular Formula | C14H23N3O7S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-amino-5-[[1-[butanoyl(carboxymethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CCCC(=O)N(CC(=O)O)C(=O)C(CS)NC(=O)CCC(N)C(=O)O |
| InChI | InChI=1S/C14H23N3O7S/c1-2-3-11(19)17(6-12(20)21)13(22)9(7-25)16-10(18)5-4-8(15)14(23)24/h8-9,25H,2-7,15H2,1H3,(H,16,18)(H,20,21)(H,23,24) |
| InChIKey | PGMMRRCNGARKQM-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|