C11H16N4O6S2 — CID 88584896
2-amino-5-[[1-[carboxymethyl(isothiocyanato)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 88584896) has the molecular formula C11H16N4O6S2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-amino-5-[[1-[carboxymethyl(isothiocyanato)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[1-[carboxymethyl(isothiocyanato)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 88584896 |
| Molecular Formula | C11H16N4O6S2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2-amino-5-[[1-[carboxymethyl(isothiocyanato)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)NC(CS)C(=O)N(CC(=O)O)N=C=S)C(=O)O |
| InChI | InChI=1S/C11H16N4O6S2/c12-6(11(20)21)1-2-8(16)14-7(4-22)10(19)15(13-5-23)3-9(17)18/h6-7,22H,1-4,12H2,(H,14,16)(H,17,18)(H,20,21) |
| InChIKey | KVCLGBBVJXFTMR-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 162.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|