C11H16N4O6S — CID 121320709
2-amino-5-[[1-[carboxymethyl(cyano)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 121320709) has the molecular formula C11H16N4O6S and a molecular weight of 332.34 g/mol. Its IUPAC name is 2-amino-5-[[1-[carboxymethyl(cyano)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[1-[carboxymethyl(cyano)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 121320709 |
| Molecular Formula | C11H16N4O6S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-amino-5-[[1-[carboxymethyl(cyano)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | N#CN(CC(=O)O)C(=O)C(CS)NC(=O)CCC(N)C(=O)O |
| InChI | InChI=1S/C11H16N4O6S/c12-5-15(3-9(17)18)10(19)7(4-22)14-8(16)2-1-6(13)11(20)21/h6-7,22H,1-4,13H2,(H,14,16)(H,17,18)(H,20,21) |
| InChIKey | LAYBKYJKMRNPIN-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 173.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|