C15H28N3O9PS — CID 87481033
2-amino-5-[[1-[carboxymethyl(diethoxyphosphorylmethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 87481033) has the molecular formula C15H28N3O9PS and a molecular weight of 457.44 g/mol. Its IUPAC name is 2-amino-5-[[1-[carboxymethyl(diethoxyphosphorylmethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[1-[carboxymethyl(diethoxyphosphorylmethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 87481033 |
| Molecular Formula | C15H28N3O9PS |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2-amino-5-[[1-[carboxymethyl(diethoxyphosphorylmethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CCOP(=O)(CN(CC(=O)O)C(=O)C(CS)NC(=O)CCC(N)C(=O)O)OCC |
| InChI | InChI=1S/C15H28N3O9PS/c1-3-26-28(25,27-4-2)9-18(7-13(20)21)14(22)11(8-29)17-12(19)6-5-10(16)15(23)24/h10-11,29H,3-9,16H2,1-2H3,(H,17,19)(H,20,21)(H,23,24) |
| InChIKey | WHRXBJQMCOKEFL-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 185.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|