C20H14BrF5N2O2S2 — CID 87466707
4-(3-bromophenyl)-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole (PubChem CID 87466707) has the molecular formula C20H14BrF5N2O2S2 and a molecular weight of 553.37 g/mol. Its IUPAC name is 4-(3-bromophenyl)-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole.
| Compound Name | 4-(3-bromophenyl)-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 87466707 |
| Molecular Formula | C20H14BrF5N2O2S2 |
| Molecular Weight | 553.37 g/mol |
| Exact Mass | 551.96 |
| IUPAC Name | 4-(3-bromophenyl)-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole |
| SMILES | O=S(=O)(c1c(F)c(F)c(F)c(F)c1F)C1CCN(c2nc(-c3cccc(Br)c3)cs2)CC1 |
| InChI | InChI=1S/C20H14BrF5N2O2S2/c21-11-3-1-2-10(8-11)13-9-31-20(27-13)28-6-4-12(5-7-28)32(29,30)19-17(25)15(23)14(22)16(24)18(19)26/h1-3,8-9,12H,4-7H2 |
| InChIKey | QVJPKEKUUWBWKD-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.37 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|