C20H15Br3F2N2O2S2 — CID 87466682
4-(3-bromophenyl)-2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole (PubChem CID 87466682) has the molecular formula C20H15Br3F2N2O2S2 and a molecular weight of 657.19 g/mol. Its IUPAC name is 4-(3-bromophenyl)-2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole.
| Compound Name | 4-(3-bromophenyl)-2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 87466682 |
| Molecular Formula | C20H15Br3F2N2O2S2 |
| Molecular Weight | 657.19 g/mol |
| Exact Mass | 653.81 |
| IUPAC Name | 4-(3-bromophenyl)-2-[4-(2,5-dibromo-3,6-difluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole |
| SMILES | O=S(=O)(c1c(F)c(Br)cc(F)c1Br)C1CCN(c2nc(-c3cccc(Br)c3)cs2)CC1 |
| InChI | InChI=1S/C20H15Br3F2N2O2S2/c21-12-3-1-2-11(8-12)16-10-30-20(26-16)27-6-4-13(5-7-27)31(28,29)19-17(23)15(24)9-14(22)18(19)25/h1-3,8-10,13H,4-7H2 |
| InChIKey | KYQOHTNZTHTJKY-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.19 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|