C7H16N2O10P2 — CID 87479151
(4S)-5-[bis(phosphonomethyl)amino]-4-(hydroxyamino)-5-oxopentanoic acid (PubChem CID 87479151) has the molecular formula C7H16N2O10P2 and a molecular weight of 350.16 g/mol. Its IUPAC name is (4S)-5-[bis(phosphonomethyl)amino]-4-(hydroxyamino)-5-oxopentanoic acid.
| Compound Name | (4S)-5-[bis(phosphonomethyl)amino]-4-(hydroxyamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 87479151 |
| Molecular Formula | C7H16N2O10P2 |
| Molecular Weight | 350.16 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | (4S)-5-[bis(phosphonomethyl)amino]-4-(hydroxyamino)-5-oxopentanoic acid |
| SMILES | O=C(O)CC[C@H](NO)C(=O)N(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C7H16N2O10P2/c10-6(11)2-1-5(8-13)7(12)9(3-20(14,15)16)4-21(17,18)19/h5,8,13H,1-4H2,(H,10,11)(H2,14,15,16)(H2,17,18,19)/t5-/m0/s1 |
| InChIKey | BIVKKHGXERLYSJ-YFKPBYRVSA-N |
| XLogP | -1.70 |
| TPSA | 204.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.16 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|