C12H23N5O7 — CID 175843988
(2S)-6-amino-2-[(carbamoylamino)-[(2S)-4-carboxy-2-(hydroxyamino)butanoyl]amino]hexanoic acid (PubChem CID 175843988) has the molecular formula C12H23N5O7 and a molecular weight of 349.34 g/mol. Its IUPAC name is (2S)-6-amino-2-[(carbamoylamino)-[(2S)-4-carboxy-2-(hydroxyamino)butanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[(carbamoylamino)-[(2S)-4-carboxy-2-(hydroxyamino)butanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175843988 |
| Molecular Formula | C12H23N5O7 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (2S)-6-amino-2-[(carbamoylamino)-[(2S)-4-carboxy-2-(hydroxyamino)butanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@@H](C(=O)O)N(NC(N)=O)C(=O)[C@H](CCC(=O)O)NO |
| InChI | InChI=1S/C12H23N5O7/c13-6-2-1-3-8(11(21)22)17(15-12(14)23)10(20)7(16-24)4-5-9(18)19/h7-8,16,24H,1-6,13H2,(H,18,19)(H,21,22)(H3,14,15,23)/t7-,8-/m0/s1 |
| InChIKey | USQSBYRKDHTXTI-YUMQZZPRSA-N |
| XLogP | -1.81 |
| TPSA | 208.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|