C19H27N3 — CID 87503185
N,N-dimethyl-4-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)iminomethylideneamino]aniline (PubChem CID 87503185) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)iminomethylideneamino]aniline.
| Compound Name | N,N-dimethyl-4-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)iminomethylideneamino]aniline |
|---|---|
| PubChem CID | 87503185 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | N,N-dimethyl-4-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)iminomethylideneamino]aniline |
| SMILES | CN(C)c1ccc(N=C=NC2CC3CCC2(C)C3(C)C)cc1 |
| InChI | InChI=1S/C19H27N3/c1-18(2)14-10-11-19(18,3)17(12-14)21-13-20-15-6-8-16(9-7-15)22(4)5/h6-9,14,17H,10-12H2,1-5H3 |
| InChIKey | LCYFOOSCQGZRBZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|