C24H25FN6O4S — CID 87520767
[3-[3-fluoro-4-[4-(1-methylindazole-3-carbonyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]-methylcarbamothioic S-acid (PubChem CID 87520767) has the molecular formula C24H25FN6O4S and a molecular weight of 512.57 g/mol. Its IUPAC name is [3-[3-fluoro-4-[4-(1-methylindazole-3-carbonyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]-methylcarbamothioic S-acid.
| Compound Name | [3-[3-fluoro-4-[4-(1-methylindazole-3-carbonyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]-methylcarbamothioic S-acid |
|---|---|
| PubChem CID | 87520767 |
| Molecular Formula | C24H25FN6O4S |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | [3-[3-fluoro-4-[4-(1-methylindazole-3-carbonyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]-methylcarbamothioic S-acid |
| SMILES | CN(C(=O)S)C1CN(c2ccc(N3CCN(C(=O)c4nn(C)c5ccccc45)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H25FN6O4S/c1-27(24(34)36)20-14-31(23(33)35-20)15-7-8-19(17(25)13-15)29-9-11-30(12-10-29)22(32)21-16-5-3-4-6-18(16)28(2)26-21/h3-8,13,20H,9-12,14H2,1-2H3,(H,34,36) |
| InChIKey | KGVXXYLXQQXFOU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|