C21H21ClFN5O4S — CID 87521140
[3-[4-[4-(4-chloropyridine-3-carbonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-methylcarbamothioic S-acid (PubChem CID 87521140) has the molecular formula C21H21ClFN5O4S and a molecular weight of 493.95 g/mol. Its IUPAC name is [3-[4-[4-(4-chloropyridine-3-carbonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-methylcarbamothioic S-acid.
| Compound Name | [3-[4-[4-(4-chloropyridine-3-carbonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-methylcarbamothioic S-acid |
|---|---|
| PubChem CID | 87521140 |
| Molecular Formula | C21H21ClFN5O4S |
| Molecular Weight | 493.95 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | [3-[4-[4-(4-chloropyridine-3-carbonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-methylcarbamothioic S-acid |
| SMILES | CN(C(=O)S)C1CN(c2ccc(N3CCN(C(=O)c4cnccc4Cl)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H21ClFN5O4S/c1-25(21(31)33)18-12-28(20(30)32-18)13-2-3-17(16(23)10-13)26-6-8-27(9-7-26)19(29)14-11-24-5-4-15(14)22/h2-5,10-11,18H,6-9,12H2,1H3,(H,31,33) |
| InChIKey | UVKUTEIZWWHJOL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.95 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|