C21H22ClFN4O4S2 — CID 25164729
S-methyl N-[3-[4-[4-(5-chlorothiophene-2-carbonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-methylcarbamothioate (PubChem CID 25164729) has the molecular formula C21H22ClFN4O4S2 and a molecular weight of 513.02 g/mol. Its IUPAC name is S-methyl N-[3-[4-[4-(5-chlorothiophene-2-carbonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-methylcarbamothioate.
| Compound Name | S-methyl N-[3-[4-[4-(5-chlorothiophene-2-carbonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-methylcarbamothioate |
|---|---|
| PubChem CID | 25164729 |
| Molecular Formula | C21H22ClFN4O4S2 |
| Molecular Weight | 513.02 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | S-methyl N-[3-[4-[4-(5-chlorothiophene-2-carbonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-methylcarbamothioate |
| SMILES | CSC(=O)N(C)C1CN(c2ccc(N3CCN(C(=O)c4ccc(Cl)s4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H22ClFN4O4S2/c1-24(21(30)32-2)18-12-27(20(29)31-18)13-3-4-15(14(23)11-13)25-7-9-26(10-8-25)19(28)16-5-6-17(22)33-16/h3-6,11,18H,7-10,12H2,1-2H3 |
| InChIKey | YAVCAEYHUNPFNB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.02 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|