C20H23F3N4O4S — CID 91557168
O-methyl N-[(5S)-3-[4-[4-(2,2-difluorocyclopropanecarbonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-methylcarbamothioate (PubChem CID 91557168) has the molecular formula C20H23F3N4O4S and a molecular weight of 472.49 g/mol. Its IUPAC name is O-methyl N-[(5S)-3-[4-[4-(2,2-difluorocyclopropanecarbonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-methylcarbamothioate.
| Compound Name | O-methyl N-[(5S)-3-[4-[4-(2,2-difluorocyclopropanecarbonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-methylcarbamothioate |
|---|---|
| PubChem CID | 91557168 |
| Molecular Formula | C20H23F3N4O4S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | O-methyl N-[(5S)-3-[4-[4-(2,2-difluorocyclopropanecarbonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-methylcarbamothioate |
| SMILES | COC(=S)N(C)[C@@H]1CN(c2ccc(N3CCN(C(=O)C4CC4(F)F)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H23F3N4O4S/c1-24(19(32)30-2)16-11-27(18(29)31-16)12-3-4-15(14(21)9-12)25-5-7-26(8-6-25)17(28)13-10-20(13,22)23/h3-4,9,13,16H,5-8,10-11H2,1-2H3/t13?,16-/m0/s1 |
| InChIKey | IJFAESKRNSRGAO-VYIIXAMBSA-N |
| XLogP | 2.28 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|