C21H29FN4O7S — CID 25165334
O-methyl N-[3-[4-[4-[2-(2,3-dihydroxypropoxy)acetyl]piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-methylcarbamothioate (PubChem CID 25165334) has the molecular formula C21H29FN4O7S and a molecular weight of 500.55 g/mol. Its IUPAC name is O-methyl N-[3-[4-[4-[2-(2,3-dihydroxypropoxy)acetyl]piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-methylcarbamothioate.
| Compound Name | O-methyl N-[3-[4-[4-[2-(2,3-dihydroxypropoxy)acetyl]piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-methylcarbamothioate |
|---|---|
| PubChem CID | 25165334 |
| Molecular Formula | C21H29FN4O7S |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | O-methyl N-[3-[4-[4-[2-(2,3-dihydroxypropoxy)acetyl]piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-methylcarbamothioate |
| SMILES | COC(=S)N(C)C1CN(c2ccc(N3CCN(C(=O)COCC(O)CO)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H29FN4O7S/c1-23(21(34)31-2)19-10-26(20(30)33-19)14-3-4-17(16(22)9-14)24-5-7-25(8-6-24)18(29)13-32-12-15(28)11-27/h3-4,9,15,19,27-28H,5-8,10-13H2,1-2H3 |
| InChIKey | BDHZDOONHZZKKL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 115.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|