C24H23FN4O5S — CID 87521160
[3-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamothioic S-acid (PubChem CID 87521160) has the molecular formula C24H23FN4O5S and a molecular weight of 498.54 g/mol. Its IUPAC name is [3-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamothioic S-acid.
| Compound Name | [3-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamothioic S-acid |
|---|---|
| PubChem CID | 87521160 |
| Molecular Formula | C24H23FN4O5S |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | [3-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamothioic S-acid |
| SMILES | O=C(S)NCC1CN(c2ccc(N3CCN(C(=O)c4cc5ccccc5o4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H23FN4O5S/c25-18-12-16(29-14-17(33-24(29)32)13-26-23(31)35)5-6-19(18)27-7-9-28(10-8-27)22(30)21-11-15-3-1-2-4-20(15)34-21/h1-6,11-12,17H,7-10,13-14H2,(H2,26,31,35) |
| InChIKey | UNPXHVNZJKOREE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|