C25H25FN4O5S — CID 87527544
[(5S)-3-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]-3-fluoro-2-methylphenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamothioic S-acid (PubChem CID 87527544) has the molecular formula C25H25FN4O5S and a molecular weight of 512.56 g/mol. Its IUPAC name is [(5S)-3-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]-3-fluoro-2-methylphenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamothioic S-acid.
| Compound Name | [(5S)-3-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]-3-fluoro-2-methylphenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamothioic S-acid |
|---|---|
| PubChem CID | 87527544 |
| Molecular Formula | C25H25FN4O5S |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | [(5S)-3-[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]-3-fluoro-2-methylphenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamothioic S-acid |
| SMILES | Cc1c(N2C[C@H](CNC(=O)S)OC2=O)ccc(N2CCN(C(=O)c3cc4ccccc4o3)CC2)c1F |
| InChI | InChI=1S/C25H25FN4O5S/c1-15-18(30-14-17(34-25(30)33)13-27-24(32)36)6-7-19(22(15)26)28-8-10-29(11-9-28)23(31)21-12-16-4-2-3-5-20(16)35-21/h2-7,12,17H,8-11,13-14H2,1H3,(H2,27,32,36)/t17-/m0/s1 |
| InChIKey | WGVVATGKHLSLTJ-KRWDZBQOSA-N |
| XLogP | 3.81 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|