C12H18O4 — CID 87531602
[3-hydroxy-2-(hydroxymethyl)-2-prop-2-enylpent-4-enyl] prop-2-enoate (PubChem CID 87531602) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is [3-hydroxy-2-(hydroxymethyl)-2-prop-2-enylpent-4-enyl] prop-2-enoate.
| Compound Name | [3-hydroxy-2-(hydroxymethyl)-2-prop-2-enylpent-4-enyl] prop-2-enoate |
|---|---|
| PubChem CID | 87531602 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | [3-hydroxy-2-(hydroxymethyl)-2-prop-2-enylpent-4-enyl] prop-2-enoate |
| SMILES | C=CCC(CO)(COC(=O)C=C)C(O)C=C |
| InChI | InChI=1S/C12H18O4/c1-4-7-12(8-13,10(14)5-2)9-16-11(15)6-3/h4-6,10,13-14H,1-3,7-9H2 |
| InChIKey | DAGKNBKDUGAPQG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|