C25H35ClN2O5 — CID 87544431
pentyl N-[(3R,4S)-8-tert-butyl-7-chloro-3-hydroxy-2,2,9-trimethyl-6-oxido-3,4-dihydropyrano[2,3-g]quinolin-6-ium-4-yl]carbamate (PubChem CID 87544431) has the molecular formula C25H35ClN2O5 and a molecular weight of 479.02 g/mol. Its IUPAC name is pentyl N-[(3R,4S)-8-tert-butyl-7-chloro-3-hydroxy-2,2,9-trimethyl-6-oxido-3,4-dihydropyrano[2,3-g]quinolin-6-ium-4-yl]carbamate.
| Compound Name | pentyl N-[(3R,4S)-8-tert-butyl-7-chloro-3-hydroxy-2,2,9-trimethyl-6-oxido-3,4-dihydropyrano[2,3-g]quinolin-6-ium-4-yl]carbamate |
|---|---|
| PubChem CID | 87544431 |
| Molecular Formula | C25H35ClN2O5 |
| Molecular Weight | 479.02 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | pentyl N-[(3R,4S)-8-tert-butyl-7-chloro-3-hydroxy-2,2,9-trimethyl-6-oxido-3,4-dihydropyrano[2,3-g]quinolin-6-ium-4-yl]carbamate |
| SMILES | CCCCCOC(=O)N[C@H]1c2cc3c(cc2OC(C)(C)[C@@H]1O)c(C)c(C(C)(C)C)c(Cl)[n+]3[O-] |
| InChI | InChI=1S/C25H35ClN2O5/c1-8-9-10-11-32-23(30)27-20-16-12-17-15(13-18(16)33-25(6,7)21(20)29)14(2)19(24(3,4)5)22(26)28(17)31/h12-13,20-21,29H,8-11H2,1-7H3,(H,27,30)/t20-,21+/m0/s1 |
| InChIKey | RWKUNUFYVJGEOE-LEWJYISDSA-N |
| XLogP | 5.22 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.02 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|