About methanetetracarboxamide
methanetetracarboxamide (PubChem CID 87547104) has the molecular formula C5H8N4O4
and a molecular weight of 188.14 g/mol. Its IUPAC name is methanetetracarboxamide.
Molecular Properties
| Compound Name | methanetetracarboxamide |
| PubChem CID | 87547104 |
| Molecular Formula | C5H8N4O4 |
| Molecular Weight | 188.14 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | methanetetracarboxamide |
| SMILES | NC(=O)C(C(N)=O)(C(N)=O)C(N)=O |
| InChI | InChI=1S/C5H8N4O4/c6-1(10)5(2(7)11,3(8)12)4(9)13/h(H2,6,10)(H2,7,11)(H2,8,12)(H2,9,13) |
| InChIKey | ITTCEADIDBNWOI-UHFFFAOYSA-N |
| XLogP | -4.09 |
| TPSA | 172.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.14 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methanetetracarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanetetracarboxamide?
The IUPAC name of methanetetracarboxamide (CID 87547104) is methanetetracarboxamide.
What is the SMILES notation for methanetetracarboxamide?
The canonical SMILES for methanetetracarboxamide is NC(=O)C(C(N)=O)(C(N)=O)C(N)=O.
What is the InChIKey of methanetetracarboxamide?
The InChIKey is ITTCEADIDBNWOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O4/c6-1(10)5(2(7)11,3(8)12)4(9)13/h(H2,6,10)(H2,7,11)(H2,8,12)(H2,9,13).
What are the key properties of methanetetracarboxamide?
methanetetracarboxamide has a molecular weight of 188.14 g/mol, XLogP of -4.09, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanetetracarboxamide is sourced from PubChem (CID 87547104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).