C16H9F2N3O — CID 87561537
(3-amino-2,6-difluorophenyl)-(4-ethynyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 87561537) has the molecular formula C16H9F2N3O and a molecular weight of 297.26 g/mol. Its IUPAC name is (3-amino-2,6-difluorophenyl)-(4-ethynyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | (3-amino-2,6-difluorophenyl)-(4-ethynyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 87561537 |
| Molecular Formula | C16H9F2N3O |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (3-amino-2,6-difluorophenyl)-(4-ethynyl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | C#Cc1ccnc2[nH]cc(C(=O)c3c(F)ccc(N)c3F)c12 |
| InChI | InChI=1S/C16H9F2N3O/c1-2-8-5-6-20-16-12(8)9(7-21-16)15(22)13-10(17)3-4-11(19)14(13)18/h1,3-7H,19H2,(H,20,21) |
| InChIKey | ZDIJKZSIMDWYCY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|