C28H41FN2O10 — CID 87571930
[(2R,3S,4S,5R,6R)-6-[4-[(2-fluoro-4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hexyl carbonate (PubChem CID 87571930) has the molecular formula C28H41FN2O10 and a molecular weight of 584.64 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[4-[(2-fluoro-4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hexyl carbonate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[4-[(2-fluoro-4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hexyl carbonate |
|---|---|
| PubChem CID | 87571930 |
| Molecular Formula | C28H41FN2O10 |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[4-[(2-fluoro-4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hexyl carbonate |
| SMILES | CCCCCCOC(=O)OC[C@H]1O[C@@](O)(Oc2nn(C(C)C)c(C)c2Cc2ccc(OC)cc2F)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H41FN2O10/c1-6-7-8-9-12-38-27(35)39-15-22-23(32)24(33)25(34)28(36,40-22)41-26-20(17(4)31(30-26)16(2)3)13-18-10-11-19(37-5)14-21(18)29/h10-11,14,16,22-25,32-34,36H,6-9,12-13,15H2,1-5H3/t22-,23-,24+,25-,28-/m1/s1 |
| InChIKey | WBSJUCXUQCZNPG-ZJNQJMOLSA-N |
| XLogP | 2.75 |
| TPSA | 161.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|