About N-benzyl-N-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide
N-benzyl-N-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide (PubChem CID 87588603) has the molecular formula C17H14N2O3
and a molecular weight of 294.31 g/mol. Its IUPAC name is N-benzyl-N-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide.
Molecular Properties
| Compound Name | N-benzyl-N-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide |
| PubChem CID | 87588603 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-benzyl-N-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide |
| SMILES | N#CN(Cc1ccccc1)C(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H14N2O3/c18-12-19(11-14-4-2-1-3-5-14)17(22)9-7-13-6-8-15(20)16(21)10-13/h1-10,20-21H,11H2 |
| InChIKey | TVJZLSYVCGAZQS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide?
The IUPAC name of N-benzyl-N-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide (CID 87588603) is N-benzyl-N-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide.
What is the SMILES notation for N-benzyl-N-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide?
The canonical SMILES for N-benzyl-N-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide is N#CN(Cc1ccccc1)C(=O)C=Cc1ccc(O)c(O)c1.
What is the InChIKey of N-benzyl-N-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide?
The InChIKey is TVJZLSYVCGAZQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O3/c18-12-19(11-14-4-2-1-3-5-14)17(22)9-7-13-6-8-15(20)16(21)10-13/h1-10,20-21H,11H2.
What are the key properties of N-benzyl-N-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide?
N-benzyl-N-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide has a molecular weight of 294.31 g/mol, XLogP of 2.62, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide is sourced from PubChem (CID 87588603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).