C22H22N2O3S — CID 87616678
N-[(1R,2R)-2-amino-1,2-diphenylethyl]-1-(4-methylphenyl)-1-oxomethanesulfonamide (PubChem CID 87616678) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-[(1R,2R)-2-amino-1,2-diphenylethyl]-1-(4-methylphenyl)-1-oxomethanesulfonamide.
| Compound Name | N-[(1R,2R)-2-amino-1,2-diphenylethyl]-1-(4-methylphenyl)-1-oxomethanesulfonamide |
|---|---|
| PubChem CID | 87616678 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[(1R,2R)-2-amino-1,2-diphenylethyl]-1-(4-methylphenyl)-1-oxomethanesulfonamide |
| SMILES | Cc1ccc(C(=O)S(=O)(=O)N[C@H](c2ccccc2)[C@H](N)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N2O3S/c1-16-12-14-19(15-13-16)22(25)28(26,27)24-21(18-10-6-3-7-11-18)20(23)17-8-4-2-5-9-17/h2-15,20-21,24H,23H2,1H3/t20-,21-/m1/s1 |
| InChIKey | GRYZDLVGPOLTBM-NHCUHLMSSA-N |
| XLogP | 3.50 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|