C13H31O8PSi — CID 87617922
[1-[diethoxy(propyl)silyl]oxy-1,2-diethoxyethyl]phosphonic acid (PubChem CID 87617922) has the molecular formula C13H31O8PSi and a molecular weight of 374.44 g/mol. Its IUPAC name is [1-[diethoxy(propyl)silyl]oxy-1,2-diethoxyethyl]phosphonic acid.
| Compound Name | [1-[diethoxy(propyl)silyl]oxy-1,2-diethoxyethyl]phosphonic acid |
|---|---|
| PubChem CID | 87617922 |
| Molecular Formula | C13H31O8PSi |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [1-[diethoxy(propyl)silyl]oxy-1,2-diethoxyethyl]phosphonic acid |
| SMILES | CCC[Si](OCC)(OCC)OC(COCC)(OCC)P(=O)(O)O |
| InChI | InChI=1S/C13H31O8PSi/c1-6-11-23(19-9-4,20-10-5)21-13(18-8-3,12-17-7-2)22(14,15)16/h6-12H2,1-5H3,(H2,14,15,16) |
| InChIKey | LYVANCMJESDTEB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|