C16H22N4O4S2 — CID 87633920
2-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-N'-hydroxypentanediamide (PubChem CID 87633920) has the molecular formula C16H22N4O4S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-N'-hydroxypentanediamide.
| Compound Name | 2-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-N'-hydroxypentanediamide |
|---|---|
| PubChem CID | 87633920 |
| Molecular Formula | C16H22N4O4S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 2-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-N'-hydroxypentanediamide |
| SMILES | CC(C)(C)c1cnc(CSc2cnc(C(CCC(=O)NO)C(N)=O)s2)o1 |
| InChI | InChI=1S/C16H22N4O4S2/c1-16(2,3)10-6-18-12(24-10)8-25-13-7-19-15(26-13)9(14(17)22)4-5-11(21)20-23/h6-7,9,23H,4-5,8H2,1-3H3,(H2,17,22)(H,20,21) |
| InChIKey | INPWGBPSPDHMLH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|