C20H21NO3 — CID 87637288
oxiran-2-ylmethyl 2-[1-(2-phenylethenyl)cyclopropyl]prop-2-enoate;prop-2-enenitrile (PubChem CID 87637288) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-[1-(2-phenylethenyl)cyclopropyl]prop-2-enoate;prop-2-enenitrile.
| Compound Name | oxiran-2-ylmethyl 2-[1-(2-phenylethenyl)cyclopropyl]prop-2-enoate;prop-2-enenitrile |
|---|---|
| PubChem CID | 87637288 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | oxiran-2-ylmethyl 2-[1-(2-phenylethenyl)cyclopropyl]prop-2-enoate;prop-2-enenitrile |
| SMILES | C=C(C(=O)OCC1CO1)C1(C=Cc2ccccc2)CC1.C=CC#N |
| InChI | InChI=1S/C17H18O3.C3H3N/c1-13(16(18)20-12-15-11-19-15)17(9-10-17)8-7-14-5-3-2-4-6-14;1-2-3-4/h2-8,15H,1,9-12H2;2H,1H2 |
| InChIKey | CTVCZJVKXJKOJZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|