C20H17NO3S — CID 8764745
[(1R)-2-oxocyclohexyl] 2-(2-cyanophenyl)sulfanylbenzoate (PubChem CID 8764745) has the molecular formula C20H17NO3S and a molecular weight of 351.43 g/mol. Its IUPAC name is [(1R)-2-oxocyclohexyl] 2-(2-cyanophenyl)sulfanylbenzoate.
| Compound Name | [(1R)-2-oxocyclohexyl] 2-(2-cyanophenyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 8764745 |
| Molecular Formula | C20H17NO3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | [(1R)-2-oxocyclohexyl] 2-(2-cyanophenyl)sulfanylbenzoate |
| SMILES | N#Cc1ccccc1Sc1ccccc1C(=O)O[C@@H]1CCCCC1=O |
| InChI | InChI=1S/C20H17NO3S/c21-13-14-7-1-5-11-18(14)25-19-12-6-2-8-15(19)20(23)24-17-10-4-3-9-16(17)22/h1-2,5-8,11-12,17H,3-4,9-10H2/t17-/m1/s1 |
| InChIKey | LOHXAIKGOPMQAS-QGZVFWFLSA-N |
| XLogP | 4.38 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |