C27H29F7N4O5 — CID 87651545
1-(4-fluorophenyl)-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide;bis(2,2,2-trifluoroacetate) (PubChem CID 87651545) has the molecular formula C27H29F7N4O5 and a molecular weight of 622.54 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide;bis(2,2,2-trifluoroacetate).
| Compound Name | 1-(4-fluorophenyl)-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 87651545 |
| Molecular Formula | C27H29F7N4O5 |
| Molecular Weight | 622.54 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)-2H-imidazo[1,5-a]pyridin-4-ium-3-carboxamide;bis(2,2,2-trifluoroacetate) |
| SMILES | CC1(C)CC(NC(=O)c2[nH]c(-c3ccc(F)cc3)c3cccc[n+]23)CC(C)(C)[NH2+]1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C23H27FN4O.2C2HF3O2/c1-22(2)13-17(14-23(3,4)27-22)25-21(29)20-26-19(15-8-10-16(24)11-9-15)18-7-5-6-12-28(18)20;2*3-2(4,5)1(6)7/h5-12,17,27H,13-14H2,1-4H3,(H,25,29);2*(H,6,7) |
| InChIKey | ONVBQTWXTZTJHA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.54 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|