C9H19BrN2O2 — CID 87656093
2-bromo-N-carbamoyl-2-ethylbutanamide;ethane (PubChem CID 87656093) has the molecular formula C9H19BrN2O2 and a molecular weight of 267.17 g/mol. Its IUPAC name is 2-bromo-N-carbamoyl-2-ethylbutanamide;ethane.
| Compound Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;ethane |
|---|---|
| PubChem CID | 87656093 |
| Molecular Formula | C9H19BrN2O2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;ethane |
| SMILES | CC.CCC(Br)(CC)C(=O)NC(N)=O |
| InChI | InChI=1S/C7H13BrN2O2.C2H6/c1-3-7(8,4-2)5(11)10-6(9)12;1-2/h3-4H2,1-2H3,(H3,9,10,11,12);1-2H3 |
| InChIKey | UYUQFNRVUHIXKS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|