C7H13BrFeN2O6P — CID 88764343
2-bromo-N-carbamoyl-2-ethylbutanamide;iron(3+);phosphate (PubChem CID 88764343) has the molecular formula C7H13BrFeN2O6P and a molecular weight of 387.91 g/mol. Its IUPAC name is 2-bromo-N-carbamoyl-2-ethylbutanamide;iron(3+);phosphate.
| Compound Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;iron(3+);phosphate |
|---|---|
| PubChem CID | 88764343 |
| Molecular Formula | C7H13BrFeN2O6P |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 386.90 |
| IUPAC Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;iron(3+);phosphate |
| SMILES | CCC(Br)(CC)C(=O)NC(N)=O.O=P([O-])([O-])[O-].[Fe+3] |
| InChI | InChI=1S/C7H13BrN2O2.Fe.H3O4P/c1-3-7(8,4-2)5(11)10-6(9)12;;1-5(2,3)4/h3-4H2,1-2H3,(H3,9,10,11,12);;(H3,1,2,3,4)/q;+3;/p-3 |
| InChIKey | SVMVBTJIRKKCAB-UHFFFAOYSA-K |
| XLogP | -1.69 |
| TPSA | 158.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|