C3BrCl5N4 — CID 87664920
2-bromo-5-(1,1,2,2,2-pentachloroethyl)tetrazole (PubChem CID 87664920) has the molecular formula C3BrCl5N4 and a molecular weight of 349.23 g/mol. Its IUPAC name is 2-bromo-5-(1,1,2,2,2-pentachloroethyl)tetrazole.
| Compound Name | 2-bromo-5-(1,1,2,2,2-pentachloroethyl)tetrazole |
|---|---|
| PubChem CID | 87664920 |
| Molecular Formula | C3BrCl5N4 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 345.77 |
| IUPAC Name | 2-bromo-5-(1,1,2,2,2-pentachloroethyl)tetrazole |
| SMILES | ClC(Cl)(Cl)C(Cl)(Cl)c1nnn(Br)n1 |
| InChI | InChI=1S/C3BrCl5N4/c4-13-11-1(10-12-13)2(5,6)3(7,8)9 |
| InChIKey | ZNNIIZXXNNDVHZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|