C20H25ClN3O2S+ — CID 8767433
1-[5-chloro-2-(3-methylphenoxy)phenyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 8767433) has the molecular formula C20H25ClN3O2S+ and a molecular weight of 406.96 g/mol. Its IUPAC name is 1-[5-chloro-2-(3-methylphenoxy)phenyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[5-chloro-2-(3-methylphenoxy)phenyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 8767433 |
| Molecular Formula | C20H25ClN3O2S+ |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 1-[5-chloro-2-(3-methylphenoxy)phenyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | Cc1cccc(Oc2ccc(Cl)cc2NC(=S)NCC[NH+]2CCOCC2)c1 |
| InChI | InChI=1S/C20H24ClN3O2S/c1-15-3-2-4-17(13-15)26-19-6-5-16(21)14-18(19)23-20(27)22-7-8-24-9-11-25-12-10-24/h2-6,13-14H,7-12H2,1H3,(H2,22,23,27)/p+1 |
| InChIKey | HZTZVRUUDIHVEU-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 46.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|