C25H44O7 — CID 87675038
[(2S,3R,4S)-4-hydroxy-2-[(3S)-3-(hydroxymethyl)dioxetan-3-yl]oxolan-3-yl] (Z)-octadec-9-enoate (PubChem CID 87675038) has the molecular formula C25H44O7 and a molecular weight of 456.62 g/mol. Its IUPAC name is [(2S,3R,4S)-4-hydroxy-2-[(3S)-3-(hydroxymethyl)dioxetan-3-yl]oxolan-3-yl] (Z)-octadec-9-enoate.
| Compound Name | [(2S,3R,4S)-4-hydroxy-2-[(3S)-3-(hydroxymethyl)dioxetan-3-yl]oxolan-3-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 87675038 |
| Molecular Formula | C25H44O7 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | [(2S,3R,4S)-4-hydroxy-2-[(3S)-3-(hydroxymethyl)dioxetan-3-yl]oxolan-3-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O[C@@H]1[C@@H](O)CO[C@@H]1[C@]1(CO)COO1 |
| InChI | InChI=1S/C25H44O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(28)31-23-21(27)18-29-24(23)25(19-26)20-30-32-25/h9-10,21,23-24,26-27H,2-8,11-20H2,1H3/b10-9-/t21-,23+,24-,25-/m0/s1 |
| InChIKey | RGFPYBQRVJWUHS-JCDPWGCISA-N |
| XLogP | 4.39 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|