C11H16N2O5 — CID 87676213
pyridine-3-carboxamide;(3S,4R)-3,4,5-trihydroxypentanal (PubChem CID 87676213) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is pyridine-3-carboxamide;(3S,4R)-3,4,5-trihydroxypentanal.
| Compound Name | pyridine-3-carboxamide;(3S,4R)-3,4,5-trihydroxypentanal |
|---|---|
| PubChem CID | 87676213 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | pyridine-3-carboxamide;(3S,4R)-3,4,5-trihydroxypentanal |
| SMILES | NC(=O)c1cccnc1.O=CC[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H6N2O.C5H10O4/c7-6(9)5-2-1-3-8-4-5;6-2-1-4(8)5(9)3-7/h1-4H,(H2,7,9);2,4-5,7-9H,1,3H2/t;4-,5+/m.0/s1 |
| InChIKey | QUDJRIIMLJFHSK-ZBTZCESGSA-N |
| XLogP | -1.53 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|