C10H12N4S — CID 87678031
1-(1,3-benzothiazol-2-yl)-2-imino-1-N'-methylethane-1,1-diamine (PubChem CID 87678031) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-2-imino-1-N'-methylethane-1,1-diamine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-2-imino-1-N'-methylethane-1,1-diamine |
|---|---|
| PubChem CID | 87678031 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-2-imino-1-N'-methylethane-1,1-diamine |
| SMILES | [H]/N=C/C(N)(NC)c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H12N4S/c1-13-10(12,6-11)9-14-7-4-2-3-5-8(7)15-9/h2-6,11,13H,12H2,1H3/b11-6+ |
| InChIKey | VQQKCFGSEKCDIA-IZZDOVSWSA-N |
| XLogP | 1.28 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|